C42H68N2 — CID 87822842
2-N-(3,4-dibutyl-5-ethylphenyl)-1-N-(3-ethyl-5-hexyl-4-octylphenyl)butane-1,2-diimine (PubChem CID 87822842) has the molecular formula C42H68N2 and a molecular weight of 601.02 g/mol. Its IUPAC name is 2-N-(3,4-dibutyl-5-ethylphenyl)-1-N-(3-ethyl-5-hexyl-4-octylphenyl)butane-1,2-diimine.
| Compound Name | 2-N-(3,4-dibutyl-5-ethylphenyl)-1-N-(3-ethyl-5-hexyl-4-octylphenyl)butane-1,2-diimine |
|---|---|
| PubChem CID | 87822842 |
| Molecular Formula | C42H68N2 |
| Molecular Weight | 601.02 g/mol |
| Exact Mass | 600.54 |
| IUPAC Name | 2-N-(3,4-dibutyl-5-ethylphenyl)-1-N-(3-ethyl-5-hexyl-4-octylphenyl)butane-1,2-diimine |
| SMILES | CCCCCCCCc1c(CC)cc(/N=C/C(CC)=N/c2cc(CC)c(CCCC)c(CCCC)c2)cc1CCCCCC |
| InChI | InChI=1S/C42H68N2/c1-8-15-19-21-22-24-28-42-34(12-5)29-39(31-37(42)26-23-20-16-9-2)43-33-38(14-7)44-40-30-35(13-6)41(27-18-11-4)36(32-40)25-17-10-3/h29-33H,8-28H2,1-7H3/b43-33+,44-38+ |
| InChIKey | HDBUBEGEDJMLJI-RIWLCZTLSA-N |
| XLogP | 13.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.02 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|