C24H32N2 — CID 87876665
1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine (PubChem CID 87876665) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine.
| Compound Name | 1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine |
|---|---|
| PubChem CID | 87876665 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine |
| SMILES | CCC(/C=N/c1cc(CC)cc(CC)c1)=N\c1cc(CC)cc(CC)c1 |
| InChI | InChI=1S/C24H32N2/c1-6-18-11-19(7-2)14-23(13-18)25-17-22(10-5)26-24-15-20(8-3)12-21(9-4)16-24/h11-17H,6-10H2,1-5H3/b25-17+,26-22+ |
| InChIKey | ORDHPIMPEAASEH-DLQZOSDBSA-N |
| XLogP | 6.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|