C22H28N2 — CID 87875436
1-N-(3,5-diethylphenyl)-2-N-phenylhexane-1,2-diimine (PubChem CID 87875436) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-N-(3,5-diethylphenyl)-2-N-phenylhexane-1,2-diimine.
| Compound Name | 1-N-(3,5-diethylphenyl)-2-N-phenylhexane-1,2-diimine |
|---|---|
| PubChem CID | 87875436 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-N-(3,5-diethylphenyl)-2-N-phenylhexane-1,2-diimine |
| SMILES | CCCCC(/C=N/c1cc(CC)cc(CC)c1)=N\c1ccccc1 |
| InChI | InChI=1S/C22H28N2/c1-4-7-11-21(24-20-12-9-8-10-13-20)17-23-22-15-18(5-2)14-19(6-3)16-22/h8-10,12-17H,4-7,11H2,1-3H3/b23-17+,24-21+ |
| InChIKey | GYGMGUBSJAOOSV-ZMXVXOAISA-N |
| XLogP | 6.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|