C24H32N2Ni — CID 87876664
1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine;nickel (PubChem CID 87876664) has the molecular formula C24H32N2Ni and a molecular weight of 407.23 g/mol. Its IUPAC name is 1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine;nickel.
| Compound Name | 1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87876664 |
| Molecular Formula | C24H32N2Ni |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-N,2-N-bis(3,5-diethylphenyl)butane-1,2-diimine;nickel |
| SMILES | CCC(/C=N/c1cc(CC)cc(CC)c1)=N\c1cc(CC)cc(CC)c1.[Ni] |
| InChI | InChI=1S/C24H32N2.Ni/c1-6-18-11-19(7-2)14-23(13-18)25-17-22(10-5)26-24-15-20(8-3)12-21(9-4)16-24;/h11-17H,6-10H2,1-5H3;/b25-17+,26-22+; |
| InChIKey | IKHIVKUYOBCRDR-LVSYWMFDSA-N |
| XLogP | 6.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|