C44H64N2 — CID 87821792
1-N-(3-butyl-4-ethyl-5-octylphenyl)-2-N-(3-ethyl-5-hexyl-4-phenylphenyl)butane-1,2-diimine (PubChem CID 87821792) has the molecular formula C44H64N2 and a molecular weight of 621.01 g/mol. Its IUPAC name is 1-N-(3-butyl-4-ethyl-5-octylphenyl)-2-N-(3-ethyl-5-hexyl-4-phenylphenyl)butane-1,2-diimine.
| Compound Name | 1-N-(3-butyl-4-ethyl-5-octylphenyl)-2-N-(3-ethyl-5-hexyl-4-phenylphenyl)butane-1,2-diimine |
|---|---|
| PubChem CID | 87821792 |
| Molecular Formula | C44H64N2 |
| Molecular Weight | 621.01 g/mol |
| Exact Mass | 620.51 |
| IUPAC Name | 1-N-(3-butyl-4-ethyl-5-octylphenyl)-2-N-(3-ethyl-5-hexyl-4-phenylphenyl)butane-1,2-diimine |
| SMILES | CCCCCCCCc1cc(/N=C/C(CC)=N/c2cc(CC)c(-c3ccccc3)c(CCCCCC)c2)cc(CCCC)c1CC |
| InChI | InChI=1S/C44H64N2/c1-7-13-16-18-19-22-28-38-32-41(31-37(25-15-9-3)43(38)12-6)45-34-40(11-5)46-42-30-35(10-4)44(36-26-23-20-24-27-36)39(33-42)29-21-17-14-8-2/h20,23-24,26-27,30-34H,7-19,21-22,25,28-29H2,1-6H3/b45-34+,46-40+ |
| InChIKey | UHNWNOZRJJRZOY-LUYXSBECSA-N |
| XLogP | 13.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.01 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|