C44H56N2 — CID 87964580
2-N-(3-butyl-4-methyl-5-phenylphenyl)-1-N-(3,4-dihexyl-5-phenylphenyl)propane-1,2-diimine (PubChem CID 87964580) has the molecular formula C44H56N2 and a molecular weight of 612.95 g/mol. Its IUPAC name is 2-N-(3-butyl-4-methyl-5-phenylphenyl)-1-N-(3,4-dihexyl-5-phenylphenyl)propane-1,2-diimine.
| Compound Name | 2-N-(3-butyl-4-methyl-5-phenylphenyl)-1-N-(3,4-dihexyl-5-phenylphenyl)propane-1,2-diimine |
|---|---|
| PubChem CID | 87964580 |
| Molecular Formula | C44H56N2 |
| Molecular Weight | 612.95 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | 2-N-(3-butyl-4-methyl-5-phenylphenyl)-1-N-(3,4-dihexyl-5-phenylphenyl)propane-1,2-diimine |
| SMILES | CCCCCCc1cc(/N=C/C(C)=N/c2cc(CCCC)c(C)c(-c3ccccc3)c2)cc(-c2ccccc2)c1CCCCCC |
| InChI | InChI=1S/C44H56N2/c1-6-9-12-16-27-39-30-40(31-44(37-25-19-15-20-26-37)42(39)28-21-13-10-7-2)45-33-34(4)46-41-29-38(22-11-8-3)35(5)43(32-41)36-23-17-14-18-24-36/h14-15,17-20,23-26,29-33H,6-13,16,21-22,27-28H2,1-5H3/b45-33+,46-34+ |
| InChIKey | HQBPHAYKISGWRI-NCOOAAOESA-N |
| XLogP | 13.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.95 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|