C49H66N2 — CID 87964520
2-N-(3-hexyl-4-octyl-5-phenylphenyl)-3-N-(3-hexyl-4-phenylphenyl)pentane-2,3-diimine (PubChem CID 87964520) has the molecular formula C49H66N2 and a molecular weight of 683.08 g/mol. Its IUPAC name is 2-N-(3-hexyl-4-octyl-5-phenylphenyl)-3-N-(3-hexyl-4-phenylphenyl)pentane-2,3-diimine.
| Compound Name | 2-N-(3-hexyl-4-octyl-5-phenylphenyl)-3-N-(3-hexyl-4-phenylphenyl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 87964520 |
| Molecular Formula | C49H66N2 |
| Molecular Weight | 683.08 g/mol |
| Exact Mass | 682.52 |
| IUPAC Name | 2-N-(3-hexyl-4-octyl-5-phenylphenyl)-3-N-(3-hexyl-4-phenylphenyl)pentane-2,3-diimine |
| SMILES | CCCCCCCCc1c(CCCCCC)cc(/N=C(C)/C(CC)=N/c2ccc(-c3ccccc3)c(CCCCCC)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C49H66N2/c1-6-10-13-16-17-26-33-47-43(32-21-15-12-8-3)37-45(38-48(47)41-29-24-19-25-30-41)50-39(5)49(9-4)51-44-34-35-46(40-27-22-18-23-28-40)42(36-44)31-20-14-11-7-2/h18-19,22-25,27-30,34-38H,6-17,20-21,26,31-33H2,1-5H3/b50-39+,51-49+ |
| InChIKey | KNHUJWIUFPYKGG-WXMNMFBXSA-N |
| XLogP | 15.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.08 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|