C44H65N2Ni- — CID 159984801
3-N-(3-butyl-5-octylphenyl)-2-N-(3-octyl-4-phenylphenyl)pentane-2,3-diimine;carbanide;nickel (PubChem CID 159984801) has the molecular formula C44H65N2Ni- and a molecular weight of 680.71 g/mol. Its IUPAC name is 3-N-(3-butyl-5-octylphenyl)-2-N-(3-octyl-4-phenylphenyl)pentane-2,3-diimine;carbanide;nickel.
| Compound Name | 3-N-(3-butyl-5-octylphenyl)-2-N-(3-octyl-4-phenylphenyl)pentane-2,3-diimine;carbanide;nickel |
|---|---|
| PubChem CID | 159984801 |
| Molecular Formula | C44H65N2Ni- |
| Molecular Weight | 680.71 g/mol |
| Exact Mass | 679.45 |
| IUPAC Name | 3-N-(3-butyl-5-octylphenyl)-2-N-(3-octyl-4-phenylphenyl)pentane-2,3-diimine;carbanide;nickel |
| SMILES | CCCCCCCCc1cc(CCCC)cc(/N=C(CC)/C(C)=N/c2ccc(-c3ccccc3)c(CCCCCCCC)c2)c1.[CH3-].[Ni] |
| InChI | InChI=1S/C43H62N2.CH3.Ni/c1-6-10-13-15-17-20-25-37-31-36(24-12-8-3)32-41(33-37)45-43(9-4)35(5)44-40-29-30-42(38-26-22-19-23-27-38)39(34-40)28-21-18-16-14-11-7-2;;/h19,22-23,26-27,29-34H,6-18,20-21,24-25,28H2,1-5H3;1H3;/q;-1;/b44-35+,45-43+;; |
| InChIKey | IGWIABHCSNCWON-CTIUZBFESA-N |
| XLogP | 14.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.71 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|