C38H60N2 — CID 87818140
2-N-(3-butyl-5-hexyl-4-methylphenyl)-3-N-(4-ethyl-3-octylphenyl)pentane-2,3-diimine (PubChem CID 87818140) has the molecular formula C38H60N2 and a molecular weight of 544.91 g/mol. Its IUPAC name is 2-N-(3-butyl-5-hexyl-4-methylphenyl)-3-N-(4-ethyl-3-octylphenyl)pentane-2,3-diimine.
| Compound Name | 2-N-(3-butyl-5-hexyl-4-methylphenyl)-3-N-(4-ethyl-3-octylphenyl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 87818140 |
| Molecular Formula | C38H60N2 |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.48 |
| IUPAC Name | 2-N-(3-butyl-5-hexyl-4-methylphenyl)-3-N-(4-ethyl-3-octylphenyl)pentane-2,3-diimine |
| SMILES | CCCCCCCCc1cc(/N=C(CC)/C(C)=N/c2cc(CCCC)c(C)c(CCCCCC)c2)ccc1CC |
| InChI | InChI=1S/C38H60N2/c1-8-13-16-18-19-21-24-35-29-36(26-25-32(35)11-4)40-38(12-5)31(7)39-37-27-33(22-15-10-3)30(6)34(28-37)23-20-17-14-9-2/h25-29H,8-24H2,1-7H3/b39-31+,40-38+ |
| InChIKey | OOWGGZNNQZBGMP-CQHNONCRSA-N |
| XLogP | 12.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|