C51H54N2 — CID 87827163
2-N-(3-ethyl-4,5-diphenylphenyl)-3-N-(4-octyl-3,5-diphenylphenyl)pentane-2,3-diimine (PubChem CID 87827163) has the molecular formula C51H54N2 and a molecular weight of 695.01 g/mol. Its IUPAC name is 2-N-(3-ethyl-4,5-diphenylphenyl)-3-N-(4-octyl-3,5-diphenylphenyl)pentane-2,3-diimine.
| Compound Name | 2-N-(3-ethyl-4,5-diphenylphenyl)-3-N-(4-octyl-3,5-diphenylphenyl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 87827163 |
| Molecular Formula | C51H54N2 |
| Molecular Weight | 695.01 g/mol |
| Exact Mass | 694.43 |
| IUPAC Name | 2-N-(3-ethyl-4,5-diphenylphenyl)-3-N-(4-octyl-3,5-diphenylphenyl)pentane-2,3-diimine |
| SMILES | CCCCCCCCc1c(-c2ccccc2)cc(/N=C(CC)/C(C)=N/c2cc(CC)c(-c3ccccc3)c(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C51H54N2/c1-5-8-9-10-11-24-33-46-47(40-25-16-12-17-26-40)35-45(36-48(46)41-27-18-13-19-28-41)53-50(7-3)38(4)52-44-34-39(6-2)51(43-31-22-15-23-32-43)49(37-44)42-29-20-14-21-30-42/h12-23,25-32,34-37H,5-11,24,33H2,1-4H3/b52-38+,53-50+ |
| InChIKey | XSRNDWOLJBZFAF-QQUJCNPBSA-N |
| XLogP | 15.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.01 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|