C50H76N2 — CID 87964233
1-N-(3-butyl-4,5-dihexylphenyl)-2-N-(3-butyl-4-octyl-5-phenylphenyl)butane-1,2-diimine (PubChem CID 87964233) has the molecular formula C50H76N2 and a molecular weight of 705.17 g/mol. Its IUPAC name is 1-N-(3-butyl-4,5-dihexylphenyl)-2-N-(3-butyl-4-octyl-5-phenylphenyl)butane-1,2-diimine.
| Compound Name | 1-N-(3-butyl-4,5-dihexylphenyl)-2-N-(3-butyl-4-octyl-5-phenylphenyl)butane-1,2-diimine |
|---|---|
| PubChem CID | 87964233 |
| Molecular Formula | C50H76N2 |
| Molecular Weight | 705.17 g/mol |
| Exact Mass | 704.60 |
| IUPAC Name | 1-N-(3-butyl-4,5-dihexylphenyl)-2-N-(3-butyl-4-octyl-5-phenylphenyl)butane-1,2-diimine |
| SMILES | CCCCCCCCc1c(CCCC)cc(/N=C(/C=N/c2cc(CCCC)c(CCCCCC)c(CCCCCC)c2)CC)cc1-c1ccccc1 |
| InChI | InChI=1S/C50H76N2/c1-7-13-18-21-22-28-35-49-44(30-17-11-5)38-47(39-50(49)41-31-25-23-26-32-41)52-45(12-6)40-51-46-36-42(29-16-10-4)48(34-27-20-15-9-3)43(37-46)33-24-19-14-8-2/h23,25-26,31-32,36-40H,7-22,24,27-30,33-35H2,1-6H3/b51-40+,52-45+ |
| InChIKey | LEVVPMAPGZBLLS-JXONDWOLSA-N |
| XLogP | 16.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.17 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|