C50H69N2+ — CID 87964252
2-(3-butyl-5-octyl-4-phenylphenyl)ethenyl-ethyl-(3-ethyl-5-octyl-4-phenylphenyl)iminoazanium (PubChem CID 87964252) has the molecular formula C50H69N2+ and a molecular weight of 698.12 g/mol. Its IUPAC name is 2-(3-butyl-5-octyl-4-phenylphenyl)ethenyl-ethyl-(3-ethyl-5-octyl-4-phenylphenyl)iminoazanium.
| Compound Name | 2-(3-butyl-5-octyl-4-phenylphenyl)ethenyl-ethyl-(3-ethyl-5-octyl-4-phenylphenyl)iminoazanium |
|---|---|
| PubChem CID | 87964252 |
| Molecular Formula | C50H69N2+ |
| Molecular Weight | 698.12 g/mol |
| Exact Mass | 697.55 |
| IUPAC Name | 2-(3-butyl-5-octyl-4-phenylphenyl)ethenyl-ethyl-(3-ethyl-5-octyl-4-phenylphenyl)iminoazanium |
| SMILES | CCCCCCCCc1cc(/N=[N+](/C=Cc2cc(CCCC)c(-c3ccccc3)c(CCCCCCCC)c2)CC)cc(CC)c1-c1ccccc1 |
| InChI | InChI=1S/C50H69N2/c1-6-11-14-16-18-22-33-46-38-41(37-45(28-13-8-3)50(46)44-31-26-21-27-32-44)35-36-52(10-5)51-48-39-42(9-4)49(43-29-24-20-25-30-43)47(40-48)34-23-19-17-15-12-7-2/h20-21,24-27,29-32,35-40H,6-19,22-23,28,33-34H2,1-5H3/q+1/b36-35?,52-51+ |
| InChIKey | VTNOZFRWMUXOBL-RQSWBEGSSA-N |
| XLogP | 15.52 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.12 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|