C48H57N2+ — CID 91114922
1-(3,4-dihexylphenyl)but-1-en-2-yl-ethyl-(3,4,5-triphenylphenyl)iminoazanium (PubChem CID 91114922) has the molecular formula C48H57N2+ and a molecular weight of 662.00 g/mol. Its IUPAC name is 1-(3,4-dihexylphenyl)but-1-en-2-yl-ethyl-(3,4,5-triphenylphenyl)iminoazanium.
| Compound Name | 1-(3,4-dihexylphenyl)but-1-en-2-yl-ethyl-(3,4,5-triphenylphenyl)iminoazanium |
|---|---|
| PubChem CID | 91114922 |
| Molecular Formula | C48H57N2+ |
| Molecular Weight | 662.00 g/mol |
| Exact Mass | 661.45 |
| IUPAC Name | 1-(3,4-dihexylphenyl)but-1-en-2-yl-ethyl-(3,4,5-triphenylphenyl)iminoazanium |
| SMILES | CCCCCCc1ccc(C=C(CC)/[N+](CC)=N/c2cc(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2)cc1CCCCCC |
| InChI | InChI=1S/C48H57N2/c1-5-9-11-16-24-39-33-32-38(34-43(39)31-17-12-10-6-2)35-45(7-3)50(8-4)49-44-36-46(40-25-18-13-19-26-40)48(42-29-22-15-23-30-42)47(37-44)41-27-20-14-21-28-41/h13-15,18-23,25-30,32-37H,5-12,16-17,24,31H2,1-4H3/q+1/b45-35?,50-49+ |
| InChIKey | RUODGQBVJNTOJC-VJAFVPJTSA-N |
| XLogP | 14.50 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.00 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|