C41H67N2+ — CID 90757792
ethyl-(3-ethyl-4,5-dioctylphenyl)imino-[1-(3-hexylphenyl)prop-1-en-2-yl]azanium (PubChem CID 90757792) has the molecular formula C41H67N2+ and a molecular weight of 588.00 g/mol. Its IUPAC name is ethyl-(3-ethyl-4,5-dioctylphenyl)imino-[1-(3-hexylphenyl)prop-1-en-2-yl]azanium.
| Compound Name | ethyl-(3-ethyl-4,5-dioctylphenyl)imino-[1-(3-hexylphenyl)prop-1-en-2-yl]azanium |
|---|---|
| PubChem CID | 90757792 |
| Molecular Formula | C41H67N2+ |
| Molecular Weight | 588.00 g/mol |
| Exact Mass | 587.53 |
| IUPAC Name | ethyl-(3-ethyl-4,5-dioctylphenyl)imino-[1-(3-hexylphenyl)prop-1-en-2-yl]azanium |
| SMILES | CCCCCCCCc1cc(/N=[N+](\CC)C(C)=Cc2cccc(CCCCCC)c2)cc(CC)c1CCCCCCCC |
| InChI | InChI=1S/C41H67N2/c1-7-12-15-18-20-23-29-39-34-40(33-38(10-4)41(39)30-24-21-19-16-13-8-2)42-43(11-5)35(6)31-37-28-25-27-36(32-37)26-22-17-14-9-3/h25,27-28,31-34H,7-24,26,29-30H2,1-6H3/q+1/b35-31?,43-42+ |
| InChIKey | IXJIKSGEUHAOJD-UZIBPGFFSA-N |
| XLogP | 13.35 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.00 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|