C39H62N2 — CID 87820169
1-(4-butyl-3-ethyl-5-hexylphenyl)prop-1-en-2-yl-(3,4-diethyl-5-octylphenyl)diazene (PubChem CID 87820169) has the molecular formula C39H62N2 and a molecular weight of 558.94 g/mol. Its IUPAC name is 1-(4-butyl-3-ethyl-5-hexylphenyl)prop-1-en-2-yl-(3,4-diethyl-5-octylphenyl)diazene.
| Compound Name | 1-(4-butyl-3-ethyl-5-hexylphenyl)prop-1-en-2-yl-(3,4-diethyl-5-octylphenyl)diazene |
|---|---|
| PubChem CID | 87820169 |
| Molecular Formula | C39H62N2 |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.49 |
| IUPAC Name | 1-(4-butyl-3-ethyl-5-hexylphenyl)prop-1-en-2-yl-(3,4-diethyl-5-octylphenyl)diazene |
| SMILES | CCCCCCCCc1cc(/N=N/C(C)=Cc2cc(CC)c(CCCC)c(CCCCCC)c2)cc(CC)c1CC |
| InChI | InChI=1S/C39H62N2/c1-8-14-17-19-20-22-24-36-30-37(29-34(12-5)38(36)13-6)41-40-31(7)26-32-27-33(11-4)39(25-16-10-3)35(28-32)23-21-18-15-9-2/h26-30H,8-25H2,1-7H3/b31-26?,41-40+ |
| InChIKey | ACEJUJQPACJYMN-KJIPOSFMSA-N |
| XLogP | 12.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|