C34H51N — CID 87820430
N-(3-butyl-5-ethylphenyl)-1-(3,4-diethyl-5-hexylphenyl)-2-methylpent-1-en-3-imine (PubChem CID 87820430) has the molecular formula C34H51N and a molecular weight of 473.79 g/mol. Its IUPAC name is N-(3-butyl-5-ethylphenyl)-1-(3,4-diethyl-5-hexylphenyl)-2-methylpent-1-en-3-imine.
| Compound Name | N-(3-butyl-5-ethylphenyl)-1-(3,4-diethyl-5-hexylphenyl)-2-methylpent-1-en-3-imine |
|---|---|
| PubChem CID | 87820430 |
| Molecular Formula | C34H51N |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | N-(3-butyl-5-ethylphenyl)-1-(3,4-diethyl-5-hexylphenyl)-2-methylpent-1-en-3-imine |
| SMILES | CCCCCCc1cc(C=C(C)/C(CC)=N/c2cc(CC)cc(CCCC)c2)cc(CC)c1CC |
| InChI | InChI=1S/C34H51N/c1-8-14-16-17-19-31-23-29(22-30(11-4)33(31)12-5)20-26(7)34(13-6)35-32-24-27(10-3)21-28(25-32)18-15-9-2/h20-25H,8-19H2,1-7H3/b26-20?,35-34+ |
| InChIKey | QWCNBDMCRYURJA-YOVTXKSNSA-N |
| XLogP | 10.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|