C35H55N2+ — CID 90703603
1-(3,4-dibutyl-5-ethylphenyl)prop-1-en-2-yl-(3,4-dibutyl-5-methylphenyl)imino-methylazanium (PubChem CID 90703603) has the molecular formula C35H55N2+ and a molecular weight of 503.84 g/mol. Its IUPAC name is 1-(3,4-dibutyl-5-ethylphenyl)prop-1-en-2-yl-(3,4-dibutyl-5-methylphenyl)imino-methylazanium.
| Compound Name | 1-(3,4-dibutyl-5-ethylphenyl)prop-1-en-2-yl-(3,4-dibutyl-5-methylphenyl)imino-methylazanium |
|---|---|
| PubChem CID | 90703603 |
| Molecular Formula | C35H55N2+ |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 503.44 |
| IUPAC Name | 1-(3,4-dibutyl-5-ethylphenyl)prop-1-en-2-yl-(3,4-dibutyl-5-methylphenyl)imino-methylazanium |
| SMILES | CCCCc1cc(/N=[N+](\C)C(C)=Cc2cc(CC)c(CCCC)c(CCCC)c2)cc(C)c1CCCC |
| InChI | InChI=1S/C35H55N2/c1-9-14-18-31-25-29(24-30(13-5)35(31)21-17-12-4)23-28(7)37(8)36-33-22-27(6)34(20-16-11-3)32(26-33)19-15-10-2/h22-26H,9-21H2,1-8H3/q+1/b28-23?,37-36+ |
| InChIKey | GFCVCZLFUNJHCH-QPJSSBEZSA-N |
| XLogP | 10.71 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|