C32H49N2+ — CID 91226310
(3,5-dibutyl-4-methylphenyl)imino-[1-(3-hexyl-5-methylphenyl)prop-1-en-2-yl]-methylazanium (PubChem CID 91226310) has the molecular formula C32H49N2+ and a molecular weight of 461.76 g/mol. Its IUPAC name is (3,5-dibutyl-4-methylphenyl)imino-[1-(3-hexyl-5-methylphenyl)prop-1-en-2-yl]-methylazanium.
| Compound Name | (3,5-dibutyl-4-methylphenyl)imino-[1-(3-hexyl-5-methylphenyl)prop-1-en-2-yl]-methylazanium |
|---|---|
| PubChem CID | 91226310 |
| Molecular Formula | C32H49N2+ |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 461.39 |
| IUPAC Name | (3,5-dibutyl-4-methylphenyl)imino-[1-(3-hexyl-5-methylphenyl)prop-1-en-2-yl]-methylazanium |
| SMILES | CCCCCCc1cc(C)cc(C=C(C)/[N+](C)=N/c2cc(CCCC)c(C)c(CCCC)c2)c1 |
| InChI | InChI=1S/C32H49N2/c1-8-11-14-15-16-28-19-25(4)20-29(22-28)21-26(5)34(7)33-32-23-30(17-12-9-2)27(6)31(24-32)18-13-10-3/h19-24H,8-18H2,1-7H3/q+1/b26-21?,34-33+ |
| InChIKey | UHYKMNQAVZXOSW-MDHNDPOYSA-N |
| XLogP | 9.90 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|