C38H52N2 — CID 87818999
2-(3,5-dibutyl-4-ethylphenyl)ethenyl-(3,4-dibutyl-5-phenylphenyl)diazene (PubChem CID 87818999) has the molecular formula C38H52N2 and a molecular weight of 536.85 g/mol. Its IUPAC name is 2-(3,5-dibutyl-4-ethylphenyl)ethenyl-(3,4-dibutyl-5-phenylphenyl)diazene.
| Compound Name | 2-(3,5-dibutyl-4-ethylphenyl)ethenyl-(3,4-dibutyl-5-phenylphenyl)diazene |
|---|---|
| PubChem CID | 87818999 |
| Molecular Formula | C38H52N2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | 2-(3,5-dibutyl-4-ethylphenyl)ethenyl-(3,4-dibutyl-5-phenylphenyl)diazene |
| SMILES | CCCCc1cc(C=C/N=N/c2cc(CCCC)c(CCCC)c(-c3ccccc3)c2)cc(CCCC)c1CC |
| InChI | InChI=1S/C38H52N2/c1-6-11-18-32-26-30(27-33(19-12-7-2)36(32)10-5)24-25-39-40-35-28-34(20-13-8-3)37(23-14-9-4)38(29-35)31-21-16-15-17-22-31/h15-17,21-22,24-29H,6-14,18-20,23H2,1-5H3/b25-24?,40-39+ |
| InChIKey | GZCNPRSASWICQU-IWSVDHONSA-N |
| XLogP | 12.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|