C26H28N2NiO2 — CID 158240323
4,5-dimethylbenzene-1,2-diolate;1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+) (PubChem CID 158240323) has the molecular formula C26H28N2NiO2 and a molecular weight of 459.22 g/mol. Its IUPAC name is 4,5-dimethylbenzene-1,2-diolate;1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+).
| Compound Name | 4,5-dimethylbenzene-1,2-diolate;1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+) |
|---|---|
| PubChem CID | 158240323 |
| Molecular Formula | C26H28N2NiO2 |
| Molecular Weight | 459.22 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4,5-dimethylbenzene-1,2-diolate;1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+) |
| SMILES | CCCCC(/C=N/c1ccccc1)=N\c1ccccc1.Cc1cc([O-])c([O-])cc1C.[Ni+2] |
| InChI | InChI=1S/C18H20N2.C8H10O2.Ni/c1-2-3-10-18(20-17-13-8-5-9-14-17)15-19-16-11-6-4-7-12-16;1-5-3-7(9)8(10)4-6(5)2;/h4-9,11-15H,2-3,10H2,1H3;3-4,9-10H,1-2H3;/q;;+2/p-2/b19-15+,20-18+;; |
| InChIKey | GFLRXPDYZZNZTI-OEBFZPLPSA-L |
| XLogP | 5.80 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.22 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|