C29H34N2NiO2 — CID 158680156
1-N,2-N-bis(3,5-dimethylphenyl)hexane-1,2-diimine;4-methylbenzene-1,2-diolate;nickel(2+) (PubChem CID 158680156) has the molecular formula C29H34N2NiO2 and a molecular weight of 501.30 g/mol. Its IUPAC name is 1-N,2-N-bis(3,5-dimethylphenyl)hexane-1,2-diimine;4-methylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 1-N,2-N-bis(3,5-dimethylphenyl)hexane-1,2-diimine;4-methylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 158680156 |
| Molecular Formula | C29H34N2NiO2 |
| Molecular Weight | 501.30 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-N,2-N-bis(3,5-dimethylphenyl)hexane-1,2-diimine;4-methylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCCC(/C=N/c1cc(C)cc(C)c1)=N\c1cc(C)cc(C)c1.Cc1ccc([O-])c([O-])c1.[Ni+2] |
| InChI | InChI=1S/C22H28N2.C7H8O2.Ni/c1-6-7-8-20(24-22-13-18(4)10-19(5)14-22)15-23-21-11-16(2)9-17(3)12-21;1-5-2-3-6(8)7(9)4-5;/h9-15H,6-8H2,1-5H3;2-4,8-9H,1H3;/q;;+2/p-2/b23-15+,24-20+;; |
| InChIKey | IFACWETWPDCSBC-VVSKIQAOSA-L |
| XLogP | 6.73 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.30 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|