C32H40N2NiO2 — CID 159332092
1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+);5-pentyl-3-propylbenzene-1,2-diolate (PubChem CID 159332092) has the molecular formula C32H40N2NiO2 and a molecular weight of 543.38 g/mol. Its IUPAC name is 1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+);5-pentyl-3-propylbenzene-1,2-diolate.
| Compound Name | 1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+);5-pentyl-3-propylbenzene-1,2-diolate |
|---|---|
| PubChem CID | 159332092 |
| Molecular Formula | C32H40N2NiO2 |
| Molecular Weight | 543.38 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 1-N,2-N-diphenylhexane-1,2-diimine;nickel(2+);5-pentyl-3-propylbenzene-1,2-diolate |
| SMILES | CCCCC(/C=N/c1ccccc1)=N\c1ccccc1.CCCCCc1cc([O-])c([O-])c(CCC)c1.[Ni+2] |
| InChI | InChI=1S/C18H20N2.C14H22O2.Ni/c1-2-3-10-18(20-17-13-8-5-9-14-17)15-19-16-11-6-4-7-12-16;1-3-5-6-8-11-9-12(7-4-2)14(16)13(15)10-11;/h4-9,11-15H,2-3,10H2,1H3;9-10,15-16H,3-8H2,1-2H3;/q;;+2/p-2/b19-15+,20-18+;; |
| InChIKey | LFBVJOGMDNOUSU-OEBFZPLPSA-L |
| XLogP | 7.87 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.38 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|