C22H26N2Ni — CID 87911957
1-N-[4-[(E)-but-1-enyl]phenyl]-2-N-phenylhexane-1,2-diimine;nickel (PubChem CID 87911957) has the molecular formula C22H26N2Ni and a molecular weight of 377.16 g/mol. Its IUPAC name is 1-N-[4-[(E)-but-1-enyl]phenyl]-2-N-phenylhexane-1,2-diimine;nickel.
| Compound Name | 1-N-[4-[(E)-but-1-enyl]phenyl]-2-N-phenylhexane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87911957 |
| Molecular Formula | C22H26N2Ni |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-N-[4-[(E)-but-1-enyl]phenyl]-2-N-phenylhexane-1,2-diimine;nickel |
| SMILES | CC/C=C/c1ccc(/N=C/C(CCCC)=N/c2ccccc2)cc1.[Ni] |
| InChI | InChI=1S/C22H26N2.Ni/c1-3-5-10-19-14-16-20(17-15-19)23-18-22(11-6-4-2)24-21-12-8-7-9-13-21;/h5,7-10,12-18H,3-4,6,11H2,1-2H3;/b10-5+,23-18+,24-22+; |
| InChIKey | RAZSSHVSEGRFPS-ISLCIVNESA-N |
| XLogP | 6.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|