C25H30N2 — CID 87912107
1-N,2-N-bis(4-prop-1-enylphenyl)heptane-1,2-diimine (PubChem CID 87912107) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-N,2-N-bis(4-prop-1-enylphenyl)heptane-1,2-diimine.
| Compound Name | 1-N,2-N-bis(4-prop-1-enylphenyl)heptane-1,2-diimine |
|---|---|
| PubChem CID | 87912107 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 1-N,2-N-bis(4-prop-1-enylphenyl)heptane-1,2-diimine |
| SMILES | CC=Cc1ccc(/N=C/C(CCCCC)=N/c2ccc(C=CC)cc2)cc1 |
| InChI | InChI=1S/C25H30N2/c1-4-7-8-11-25(27-24-18-14-22(10-6-3)15-19-24)20-26-23-16-12-21(9-5-2)13-17-23/h5-6,9-10,12-20H,4,7-8,11H2,1-3H3/b9-5?,10-6?,26-20+,27-25+ |
| InChIKey | XEFSTJNMJCERNM-TWZBNZJHSA-N |
| XLogP | 7.81 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|