C14H28BN2O2 — CID 87823358
CID 87823358 (PubChem CID 87823358) has the molecular formula C14H28BN2O2 and a molecular weight of 267.20 g/mol.
| Compound Name | CID 87823358 |
|---|---|
| PubChem CID | 87823358 |
| Molecular Formula | C14H28BN2O2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | — |
| SMILES | CC(C)CC(C)C(=O)N[B]NC(=O)C(C)CC(C)C |
| InChI | InChI=1S/C14H28BN2O2/c1-9(2)7-11(5)13(18)16-15-17-14(19)12(6)8-10(3)4/h9-12H,7-8H2,1-6H3,(H,16,18)(H,17,19) |
| InChIKey | YOBIJIJQTRYFHW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|