C24H27FN4O5 — CID 87830399
2-[3-fluoro-4-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]-5-nitrobenzoyl]piperazin-1-yl]phenyl]acetaldehyde (PubChem CID 87830399) has the molecular formula C24H27FN4O5 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]-5-nitrobenzoyl]piperazin-1-yl]phenyl]acetaldehyde.
| Compound Name | 2-[3-fluoro-4-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]-5-nitrobenzoyl]piperazin-1-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87830399 |
| Molecular Formula | C24H27FN4O5 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[3-fluoro-4-[4-[2-[3-(hydroxymethyl)pyrrolidin-1-yl]-5-nitrobenzoyl]piperazin-1-yl]phenyl]acetaldehyde |
| SMILES | O=CCc1ccc(N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3N3CCC(CO)C3)CC2)c(F)c1 |
| InChI | InChI=1S/C24H27FN4O5/c25-21-13-17(6-12-30)1-3-23(21)26-8-10-27(11-9-26)24(32)20-14-19(29(33)34)2-4-22(20)28-7-5-18(15-28)16-31/h1-4,12-14,18,31H,5-11,15-16H2 |
| InChIKey | CZMJFSWAWHUEQX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|