C27H27F6NO3S — CID 87837516
1-[4-(3-cyclohexyloxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-3-morpholin-4-ylprop-2-en-1-one (PubChem CID 87837516) has the molecular formula C27H27F6NO3S and a molecular weight of 559.57 g/mol. Its IUPAC name is 1-[4-(3-cyclohexyloxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-3-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 1-[4-(3-cyclohexyloxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-3-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 87837516 |
| Molecular Formula | C27H27F6NO3S |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 1-[4-(3-cyclohexyloxyphenyl)sulfanyl-2,3-bis(trifluoromethyl)phenyl]-3-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(C=CN1CCOCC1)c1ccc(Sc2cccc(OC3CCCCC3)c2)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C27H27F6NO3S/c28-26(29,30)24-21(22(35)11-12-34-13-15-36-16-14-34)9-10-23(25(24)27(31,32)33)38-20-8-4-7-19(17-20)37-18-5-2-1-3-6-18/h4,7-12,17-18H,1-3,5-6,13-16H2 |
| InChIKey | BBVFGVBNGDSZOE-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|