C20H20Cl2N4O4 — CID 87844022
6-chloro-3-[7-[2-(2-methoxyethoxy)ethoxy]quinazolin-4-yl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride (PubChem CID 87844022) has the molecular formula C20H20Cl2N4O4 and a molecular weight of 451.31 g/mol. Its IUPAC name is 6-chloro-3-[7-[2-(2-methoxyethoxy)ethoxy]quinazolin-4-yl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride.
| Compound Name | 6-chloro-3-[7-[2-(2-methoxyethoxy)ethoxy]quinazolin-4-yl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 87844022 |
| Molecular Formula | C20H20Cl2N4O4 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-chloro-3-[7-[2-(2-methoxyethoxy)ethoxy]quinazolin-4-yl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride |
| SMILES | COCCOCCOc1ccc2c(C3C(=O)Nc4nc(Cl)ccc43)ncnc2c1.Cl |
| InChI | InChI=1S/C20H19ClN4O4.ClH/c1-27-6-7-28-8-9-29-12-2-3-13-15(10-12)22-11-23-18(13)17-14-4-5-16(21)24-19(14)25-20(17)26;/h2-5,10-11,17H,6-9H2,1H3,(H,24,25,26);1H |
| InChIKey | PUVJEAHAALODGH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|