C15H20ClNO5S — CID 87847066
4-chloro-4-oxo-3-[2-(pentan-3-ylsulfamoyl)phenyl]butanoic acid (PubChem CID 87847066) has the molecular formula C15H20ClNO5S and a molecular weight of 361.85 g/mol. Its IUPAC name is 4-chloro-4-oxo-3-[2-(pentan-3-ylsulfamoyl)phenyl]butanoic acid.
| Compound Name | 4-chloro-4-oxo-3-[2-(pentan-3-ylsulfamoyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 87847066 |
| Molecular Formula | C15H20ClNO5S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-chloro-4-oxo-3-[2-(pentan-3-ylsulfamoyl)phenyl]butanoic acid |
| SMILES | CCC(CC)NS(=O)(=O)c1ccccc1C(CC(=O)O)C(=O)Cl |
| InChI | InChI=1S/C15H20ClNO5S/c1-3-10(4-2)17-23(21,22)13-8-6-5-7-11(13)12(15(16)20)9-14(18)19/h5-8,10,12,17H,3-4,9H2,1-2H3,(H,18,19) |
| InChIKey | MFJADJPIHZABEB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|