About iridium;2-(phenylmethoxymethyl)oxirane;pyridine
iridium;2-(phenylmethoxymethyl)oxirane;pyridine (PubChem CID 87856687) has the molecular formula C15H16IrNO2-
and a molecular weight of 434.52 g/mol. Its IUPAC name is iridium;2-(phenylmethoxymethyl)oxirane;pyridine.
Molecular Properties
| Compound Name | iridium;2-(phenylmethoxymethyl)oxirane;pyridine |
| PubChem CID | 87856687 |
| Molecular Formula | C15H16IrNO2- |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | iridium;2-(phenylmethoxymethyl)oxirane;pyridine |
| SMILES | [Ir].[c-]1ccc(COCC2CO2)cc1.c1ccncc1 |
| InChI | InChI=1S/C10H11O2.C5H5N.Ir/c1-2-4-9(5-3-1)6-11-7-10-8-12-10;1-2-4-6-5-3-1;/h2-5,10H,6-8H2;1-5H;/q-1;; |
| InChIKey | XRSFGJHKDHSTSX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-(phenylmethoxymethyl)oxirane;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-(phenylmethoxymethyl)oxirane;pyridine?
The IUPAC name of iridium;2-(phenylmethoxymethyl)oxirane;pyridine (CID 87856687) is iridium;2-(phenylmethoxymethyl)oxirane;pyridine.
What is the SMILES notation for iridium;2-(phenylmethoxymethyl)oxirane;pyridine?
The canonical SMILES for iridium;2-(phenylmethoxymethyl)oxirane;pyridine is [Ir].[c-]1ccc(COCC2CO2)cc1.c1ccncc1.
What is the InChIKey of iridium;2-(phenylmethoxymethyl)oxirane;pyridine?
The InChIKey is XRSFGJHKDHSTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11O2.C5H5N.Ir/c1-2-4-9(5-3-1)6-11-7-10-8-12-10;1-2-4-6-5-3-1;/h2-5,10H,6-8H2;1-5H;/q-1;;.
What are the key properties of iridium;2-(phenylmethoxymethyl)oxirane;pyridine?
iridium;2-(phenylmethoxymethyl)oxirane;pyridine has a molecular weight of 434.52 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-(phenylmethoxymethyl)oxirane;pyridine is sourced from PubChem (CID 87856687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).