C23H40N2O3S — CID 87874410
2-[(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl]oxy-N-(2-methyl-2-nitrososulfanylpropyl)acetamide (PubChem CID 87874410) has the molecular formula C23H40N2O3S and a molecular weight of 424.65 g/mol. Its IUPAC name is 2-[(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl]oxy-N-(2-methyl-2-nitrososulfanylpropyl)acetamide.
| Compound Name | 2-[(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl]oxy-N-(2-methyl-2-nitrososulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 87874410 |
| Molecular Formula | C23H40N2O3S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-[(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl]oxy-N-(2-methyl-2-nitrososulfanylpropyl)acetamide |
| SMILES | C/C=C/C=C(/C=C/CCCCCCCCCC)OCC(=O)NCC(C)(C)SN=O |
| InChI | InChI=1S/C23H40N2O3S/c1-5-7-9-10-11-12-13-14-15-16-18-21(17-8-6-2)28-19-22(26)24-20-23(3,4)29-25-27/h6,8,16-18H,5,7,9-15,19-20H2,1-4H3,(H,24,26)/b8-6+,18-16+,21-17- |
| InChIKey | RVVJBZZRVAAVEK-OBPPJURLSA-N |
| XLogP | 6.86 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|