C27H44N2O7S — CID 87874551
[(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl] 3-acetylsulfanyl-2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]propanoate (PubChem CID 87874551) has the molecular formula C27H44N2O7S and a molecular weight of 540.72 g/mol. Its IUPAC name is [(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl] 3-acetylsulfanyl-2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]propanoate.
| Compound Name | [(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl] 3-acetylsulfanyl-2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 87874551 |
| Molecular Formula | C27H44N2O7S |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(2E,4Z,6E)-heptadeca-2,4,6-trien-5-yl] 3-acetylsulfanyl-2-[(2,2-dimethyl-3-nitrooxypropanoyl)amino]propanoate |
| SMILES | C/C=C/C=C(/C=C/CCCCCCCCCC)OC(=O)C(CSC(C)=O)NC(=O)C(C)(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C27H44N2O7S/c1-6-8-10-11-12-13-14-15-16-17-19-23(18-9-7-2)36-25(31)24(20-37-22(3)30)28-26(32)27(4,5)21-35-29(33)34/h7,9,17-19,24H,6,8,10-16,20-21H2,1-5H3,(H,28,32)/b9-7+,19-17+,23-18- |
| InChIKey | OPWXDXHBZOQIIN-VALSPWLZSA-N |
| XLogP | 6.08 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|