C18H16AsN2O2 — CID 87886095
CID 87886095 (PubChem CID 87886095) has the molecular formula C18H16AsN2O2 and a molecular weight of 367.26 g/mol.
| Compound Name | CID 87886095 |
|---|---|
| PubChem CID | 87886095 |
| Molecular Formula | C18H16AsN2O2 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | — |
| SMILES | C=CCc1c(O)c(OC)cc2ncnc([As]c3ccccc3)c12 |
| InChI | InChI=1S/C18H16AsN2O2/c1-3-7-13-16-14(10-15(23-2)17(13)22)20-11-21-18(16)19-12-8-5-4-6-9-12/h3-6,8-11,22H,1,7H2,2H3 |
| InChIKey | NFTNGTTTXUBWHR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|