C19H24O13 — CID 87887493
[2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxy-1,2,2-tri(prop-2-enoyloxy)ethyl] prop-2-enoate (PubChem CID 87887493) has the molecular formula C19H24O13 and a molecular weight of 460.39 g/mol. Its IUPAC name is [2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxy-1,2,2-tri(prop-2-enoyloxy)ethyl] prop-2-enoate.
| Compound Name | [2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxy-1,2,2-tri(prop-2-enoyloxy)ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 87887493 |
| Molecular Formula | C19H24O13 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [2-[3-hydroxy-2,2-bis(hydroxymethyl)propyl]peroxy-1,2,2-tri(prop-2-enoyloxy)ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(OC(=O)C=C)C(OOCC(CO)(CO)CO)(OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C19H24O13/c1-5-13(23)28-17(29-14(24)6-2)19(30-15(25)7-3,31-16(26)8-4)32-27-12-18(9-20,10-21)11-22/h5-8,17,20-22H,1-4,9-12H2 |
| InChIKey | HKLICIBFLFZNRH-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|