C14H15N3 — CID 87893421
2-pent-4-ynylquinoline-3,4-diamine (PubChem CID 87893421) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-pent-4-ynylquinoline-3,4-diamine.
| Compound Name | 2-pent-4-ynylquinoline-3,4-diamine |
|---|---|
| PubChem CID | 87893421 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-pent-4-ynylquinoline-3,4-diamine |
| SMILES | C#CCCCc1nc2ccccc2c(N)c1N |
| InChI | InChI=1S/C14H15N3/c1-2-3-4-9-12-14(16)13(15)10-7-5-6-8-11(10)17-12/h1,5-8H,3-4,9,16H2,(H2,15,17) |
| InChIKey | SPXUJZDXLPXHFC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|