C35H52O4S — CID 87899195
4,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)thiepane-4-carboxylic acid (PubChem CID 87899195) has the molecular formula C35H52O4S and a molecular weight of 568.86 g/mol. Its IUPAC name is 4,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)thiepane-4-carboxylic acid.
| Compound Name | 4,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)thiepane-4-carboxylic acid |
|---|---|
| PubChem CID | 87899195 |
| Molecular Formula | C35H52O4S |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | 4,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)thiepane-4-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C2CCSCCC2(C(=O)O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C35H52O4S/c1-31(2,3)24-17-21(18-25(28(24)36)32(4,5)6)23-13-15-40-16-14-35(23,30(38)39)22-19-26(33(7,8)9)29(37)27(20-22)34(10,11)12/h17-20,23,36-37H,13-16H2,1-12H3,(H,38,39) |
| InChIKey | WFNNTNDUPAPJEG-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |