C15H26O6 — CID 87901123
4-ethyl-3-hydroxy-6-(hydroxymethyl)-2-methylideneoctanoic acid;prop-2-enoic acid (PubChem CID 87901123) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-ethyl-3-hydroxy-6-(hydroxymethyl)-2-methylideneoctanoic acid;prop-2-enoic acid.
| Compound Name | 4-ethyl-3-hydroxy-6-(hydroxymethyl)-2-methylideneoctanoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 87901123 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-ethyl-3-hydroxy-6-(hydroxymethyl)-2-methylideneoctanoic acid;prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C(O)C(CC)CC(CC)CO.C=CC(=O)O |
| InChI | InChI=1S/C12H22O4.C3H4O2/c1-4-9(7-13)6-10(5-2)11(14)8(3)12(15)16;1-2-3(4)5/h9-11,13-14H,3-7H2,1-2H3,(H,15,16);2H,1H2,(H,4,5) |
| InChIKey | OSJVSLZDYDSPTM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|