C14H18ClN3O4S — CID 87906519
2-[amino(carboxy)methyl]-3-[(carbamothioylamino)-phenylmethyl]cyclopropane-1-carboxylic acid;hydrochloride (PubChem CID 87906519) has the molecular formula C14H18ClN3O4S and a molecular weight of 359.84 g/mol. Its IUPAC name is 2-[amino(carboxy)methyl]-3-[(carbamothioylamino)-phenylmethyl]cyclopropane-1-carboxylic acid;hydrochloride.
| Compound Name | 2-[amino(carboxy)methyl]-3-[(carbamothioylamino)-phenylmethyl]cyclopropane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 87906519 |
| Molecular Formula | C14H18ClN3O4S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[amino(carboxy)methyl]-3-[(carbamothioylamino)-phenylmethyl]cyclopropane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.NC(=S)NC(c1ccccc1)C1C(C(=O)O)C1C(N)C(=O)O |
| InChI | InChI=1S/C14H17N3O4S.ClH/c15-10(13(20)21)7-8(9(7)12(18)19)11(17-14(16)22)6-4-2-1-3-5-6;/h1-5,7-11H,15H2,(H,18,19)(H,20,21)(H3,16,17,22);1H |
| InChIKey | LFZBVRDCHBVPEH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|