C16H23N3O5 — CID 142099309
2-[(S)-amino(carboxy)methyl]-3-methylcyclopropane-1-carboxylic acid;1-ethyl-3-phenylurea (PubChem CID 142099309) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[(S)-amino(carboxy)methyl]-3-methylcyclopropane-1-carboxylic acid;1-ethyl-3-phenylurea.
| Compound Name | 2-[(S)-amino(carboxy)methyl]-3-methylcyclopropane-1-carboxylic acid;1-ethyl-3-phenylurea |
|---|---|
| PubChem CID | 142099309 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[(S)-amino(carboxy)methyl]-3-methylcyclopropane-1-carboxylic acid;1-ethyl-3-phenylurea |
| SMILES | CC1C(C(=O)O)C1C(N)C(=O)O.CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H12N2O.C7H11NO4/c1-2-10-9(12)11-8-6-4-3-5-7-8;1-2-3(4(2)6(9)10)5(8)7(11)12/h3-7H,2H2,1H3,(H2,10,11,12);2-5H,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | PMPUAOAUNVNEHD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |