About [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate
[2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate (PubChem CID 87908892) has the molecular formula C18H16N4O4
and a molecular weight of 352.35 g/mol. Its IUPAC name is [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate.
Molecular Properties
| Compound Name | [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate |
| PubChem CID | 87908892 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate |
| SMILES | N#CCC(=O)OCC(Cc1ccccc1)/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N4O4/c19-11-10-18(23)26-13-16(12-14-4-2-1-3-5-14)21-20-15-6-8-17(9-7-15)22(24)25/h1-9,16H,10,12-13H2/b21-20+ |
| InChIKey | NQEZCSBCRFVILQ-QZQOTICOSA-N |
| XLogP | 3.75 |
| TPSA | 117.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate?
The IUPAC name of [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate (CID 87908892) is [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate.
What is the SMILES notation for [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate?
The canonical SMILES for [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate is N#CCC(=O)OCC(Cc1ccccc1)/N=N/c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate?
The InChIKey is NQEZCSBCRFVILQ-QZQOTICOSA-N. The full InChI is InChI=1S/C18H16N4O4/c19-11-10-18(23)26-13-16(12-14-4-2-1-3-5-14)21-20-15-6-8-17(9-7-15)22(24)25/h1-9,16H,10,12-13H2/b21-20+.
What are the key properties of [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate?
[2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate has a molecular weight of 352.35 g/mol, XLogP of 3.75, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-nitrophenyl)diazenyl]-3-phenylpropyl] 2-cyanoacetate is sourced from PubChem (CID 87908892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).