C35H29ClN2O4 — CID 87913264
methyl 3-[[5-chloro-2-(naphthalen-2-ylmethylamino)benzoyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoate (PubChem CID 87913264) has the molecular formula C35H29ClN2O4 and a molecular weight of 577.08 g/mol. Its IUPAC name is methyl 3-[[5-chloro-2-(naphthalen-2-ylmethylamino)benzoyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoate.
| Compound Name | methyl 3-[[5-chloro-2-(naphthalen-2-ylmethylamino)benzoyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 87913264 |
| Molecular Formula | C35H29ClN2O4 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | methyl 3-[[5-chloro-2-(naphthalen-2-ylmethylamino)benzoyl]amino]-3-[4-(2-formylphenyl)phenyl]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(Cl)ccc1NCc1ccc2ccccc2c1)c1ccc(-c2ccccc2C=O)cc1 |
| InChI | InChI=1S/C35H29ClN2O4/c1-42-34(40)20-33(26-14-12-25(13-15-26)30-9-5-4-8-28(30)22-39)38-35(41)31-19-29(36)16-17-32(31)37-21-23-10-11-24-6-2-3-7-27(24)18-23/h2-19,22,33,37H,20-21H2,1H3,(H,38,41) |
| InChIKey | UJKNIVRBIZKJBR-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|