C14H17ClN2O — CID 87915322
(4aS,7aS)-7-(6-chloro-5-methoxy-3-pyridinyl)-2,3,4,4a,5,7a-hexahydro-1H-cyclopenta[b]pyridine (PubChem CID 87915322) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (4aS,7aS)-7-(6-chloro-5-methoxy-3-pyridinyl)-2,3,4,4a,5,7a-hexahydro-1H-cyclopenta[b]pyridine.
| Compound Name | (4aS,7aS)-7-(6-chloro-5-methoxy-3-pyridinyl)-2,3,4,4a,5,7a-hexahydro-1H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 87915322 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (4aS,7aS)-7-(6-chloro-5-methoxy-3-pyridinyl)-2,3,4,4a,5,7a-hexahydro-1H-cyclopenta[b]pyridine |
| SMILES | COc1cc(C2=CC[C@@H]3CCCN[C@H]23)cnc1Cl |
| InChI | InChI=1S/C14H17ClN2O/c1-18-12-7-10(8-17-14(12)15)11-5-4-9-3-2-6-16-13(9)11/h5,7-9,13,16H,2-4,6H2,1H3/t9-,13-/m0/s1 |
| InChIKey | OXYGZAXILQYTHI-ZANVPECISA-N |
| XLogP | 2.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|