C12H10BrN3 — CID 87915553
5-[(1R,5S)-6-azabicyclo[3.2.0]hept-3-en-4-yl]-2-bromopyridine-3-carbonitrile (PubChem CID 87915553) has the molecular formula C12H10BrN3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 5-[(1R,5S)-6-azabicyclo[3.2.0]hept-3-en-4-yl]-2-bromopyridine-3-carbonitrile.
| Compound Name | 5-[(1R,5S)-6-azabicyclo[3.2.0]hept-3-en-4-yl]-2-bromopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87915553 |
| Molecular Formula | C12H10BrN3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 5-[(1R,5S)-6-azabicyclo[3.2.0]hept-3-en-4-yl]-2-bromopyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C2=CC[C@@H]3CN[C@H]23)cnc1Br |
| InChI | InChI=1S/C12H10BrN3/c13-12-8(4-14)3-9(6-16-12)10-2-1-7-5-15-11(7)10/h2-3,6-7,11,15H,1,5H2/t7-,11+/m1/s1 |
| InChIKey | NLCCZTBTLSQMDC-HQJQHLMTSA-N |
| XLogP | 2.09 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|