C16H16Cl3N2O4P — CID 87917214
1-[4-chloro-2-(dimethoxyphosphorylmethyl)phenyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 87917214) has the molecular formula C16H16Cl3N2O4P and a molecular weight of 437.65 g/mol. Its IUPAC name is 1-[4-chloro-2-(dimethoxyphosphorylmethyl)phenyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[4-chloro-2-(dimethoxyphosphorylmethyl)phenyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 87917214 |
| Molecular Formula | C16H16Cl3N2O4P |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 1-[4-chloro-2-(dimethoxyphosphorylmethyl)phenyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | COP(=O)(Cc1cc(Cl)ccc1NC(=O)Nc1cc(Cl)cc(Cl)c1)OC |
| InChI | InChI=1S/C16H16Cl3N2O4P/c1-24-26(23,25-2)9-10-5-11(17)3-4-15(10)21-16(22)20-14-7-12(18)6-13(19)8-14/h3-8H,9H2,1-2H3,(H2,20,21,22) |
| InChIKey | ALNZJUQLDSQQSP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|