C14H24N4O4 — CID 8792380
ethyl N-[2-[[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl]-ethylamino]acetyl]carbamate (PubChem CID 8792380) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl N-[2-[[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl]-ethylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl]-ethylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 8792380 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl N-[2-[[2-[2-cyanopropan-2-yl(methyl)amino]-2-oxoethyl]-ethylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)CC(=O)N(C)C(C)(C)C#N |
| InChI | InChI=1S/C14H24N4O4/c1-6-18(8-11(19)16-13(21)22-7-2)9-12(20)17(5)14(3,4)10-15/h6-9H2,1-5H3,(H,16,19,21) |
| InChIKey | CFFIKXIEUJTQLE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |