C13H32N4 — CID 87932680
6-N-[3-(dimethylamino)propyl]-1-N,1-N-dimethylhexane-1,3,6-triamine (PubChem CID 87932680) has the molecular formula C13H32N4 and a molecular weight of 244.43 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-1-N,1-N-dimethylhexane-1,3,6-triamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-1-N,1-N-dimethylhexane-1,3,6-triamine |
|---|---|
| PubChem CID | 87932680 |
| Molecular Formula | C13H32N4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-1-N,1-N-dimethylhexane-1,3,6-triamine |
| SMILES | CN(C)CCCNCCCC(N)CCN(C)C |
| InChI | InChI=1S/C13H32N4/c1-16(2)11-6-10-15-9-5-7-13(14)8-12-17(3)4/h13,15H,5-12,14H2,1-4H3 |
| InChIKey | KTAWVWJZSYUGKY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|