C13H30O5Si — CID 87946717
1-[butyl(dimethyl)silyl]oxy-3-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol (PubChem CID 87946717) has the molecular formula C13H30O5Si and a molecular weight of 294.46 g/mol. Its IUPAC name is 1-[butyl(dimethyl)silyl]oxy-3-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol.
| Compound Name | 1-[butyl(dimethyl)silyl]oxy-3-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 87946717 |
| Molecular Formula | C13H30O5Si |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[butyl(dimethyl)silyl]oxy-3-[2-(2-hydroxyethoxy)ethoxy]propan-2-ol |
| SMILES | CCCC[Si](C)(C)OCC(O)COCCOCCO |
| InChI | InChI=1S/C13H30O5Si/c1-4-5-10-19(2,3)18-12-13(15)11-17-9-8-16-7-6-14/h13-15H,4-12H2,1-3H3 |
| InChIKey | JTDAUXMFYGPNLE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|