C23H22F3NO4S — CID 87957915
6-[[4-[3-(hydroxymethyl)piperidin-1-yl]sulfinylphenyl]methyl]-4-(trifluoromethyl)chromen-2-one (PubChem CID 87957915) has the molecular formula C23H22F3NO4S and a molecular weight of 465.49 g/mol. Its IUPAC name is 6-[[4-[3-(hydroxymethyl)piperidin-1-yl]sulfinylphenyl]methyl]-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 6-[[4-[3-(hydroxymethyl)piperidin-1-yl]sulfinylphenyl]methyl]-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 87957915 |
| Molecular Formula | C23H22F3NO4S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 6-[[4-[3-(hydroxymethyl)piperidin-1-yl]sulfinylphenyl]methyl]-4-(trifluoromethyl)chromen-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2cc(Cc3ccc(S(=O)N4CCCC(CO)C4)cc3)ccc2o1 |
| InChI | InChI=1S/C23H22F3NO4S/c24-23(25,26)20-12-22(29)31-21-8-5-16(11-19(20)21)10-15-3-6-18(7-4-15)32(30)27-9-1-2-17(13-27)14-28/h3-8,11-12,17,28H,1-2,9-10,13-14H2 |
| InChIKey | FLHGLVQDZTUKGM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|