C21H17F3N2O4S — CID 11178445
N-(2-cyanoethyl)-N-methyl-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide (PubChem CID 11178445) has the molecular formula C21H17F3N2O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-methyl-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-methyl-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11178445 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-(2-cyanoethyl)-N-methyl-4-[[2-oxo-4-(trifluoromethyl)chromen-6-yl]methyl]benzenesulfonamide |
| SMILES | CN(CCC#N)S(=O)(=O)c1ccc(Cc2ccc3oc(=O)cc(C(F)(F)F)c3c2)cc1 |
| InChI | InChI=1S/C21H17F3N2O4S/c1-26(10-2-9-25)31(28,29)16-6-3-14(4-7-16)11-15-5-8-19-17(12-15)18(21(22,23)24)13-20(27)30-19/h3-8,12-13H,2,10-11H2,1H3 |
| InChIKey | WQTRZCYWSUFGCZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|