C22H23BrN2O5S — CID 87958425
(2S)-2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-[4-(4-ethoxy-4-oxobutoxy)phenyl]propanoic acid (PubChem CID 87958425) has the molecular formula C22H23BrN2O5S and a molecular weight of 507.41 g/mol. Its IUPAC name is (2S)-2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-[4-(4-ethoxy-4-oxobutoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-[4-(4-ethoxy-4-oxobutoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 87958425 |
| Molecular Formula | C22H23BrN2O5S |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | (2S)-2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-3-[4-(4-ethoxy-4-oxobutoxy)phenyl]propanoic acid |
| SMILES | CCOC(=O)CCCOc1ccc(C[C@H](Nc2nc3ccc(Br)cc3s2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H23BrN2O5S/c1-2-29-20(26)4-3-11-30-16-8-5-14(6-9-16)12-18(21(27)28)25-22-24-17-10-7-15(23)13-19(17)31-22/h5-10,13,18H,2-4,11-12H2,1H3,(H,24,25)(H,27,28)/t18-/m0/s1 |
| InChIKey | DQGUUILGJLBAGU-SFHVURJKSA-N |
| XLogP | 4.89 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|